论文部分内容阅读
The title compound Fe(CH4N2S)2Cl22(C11H6N2O) (Mr = 643.35) has been prepared and its crystal structure was determined by X-ray diffraction method with the following data: triclinic, space group P1, a = 7.3742(10), b = 13.0427(12), c = 15.215(2) , a = 88.969(12), b = 78.004(12), g = 79.689(11)o, V = 1408.1(3) 3, Z = 2, Dx = 1.517 g/cm3, m = 0.912 mm-1 and F(000) = 656. The final R = 0.030 and wR = 0.078 for 4070 observed reflections (I > 2s(I)), and R = 0.064 and wR = 0.091 for 5516 independent ones. The crystal consists of tetrahedral Fe(II) complex and hydrogen bonded 4,5-diazafluoren-9-one (dafone). The carbonyl bridge in dafone distorts the bipyridine moiety and results in the longer N…N separation of 3.071(3) and 3.061(3) ? There exists an extensive intermolecular hydrogen bond network in the crystal, and p-p stacking is observed between the neighboring dafone rings.
The title compound Fe (CH4N2S) 2Cl22 (C11H6N2O) (Mr = 643.35) has been prepared and its crystal structure was determined by X-ray diffraction method with the following data: triclinic, space group P1, a = 7.3742 = 13.0427 (12) c = 15.215 (2) a = 88.969 (12) b = 78.004 (12) g = 79.689 (11) o V = 1408.1 (3) 3 Z = 2 Dx = 1.517 g / cm3, m = 0.912 mm-1 and F (000) = 656. The final R = 0.030 and wR = 0.078 for 4070 observed reflections (I> 2s (I)), and R = 0.064 and wR = 0.091 for 5516 independent ones. The crystal consists of tetrahedral Fe (II) complex and hydrogen bonded 4,5-diazafluoren-9-one (dafone). The carbonyl bridge in dafone distorts the bipyridine moiety and results in the longer N ... N separation of 3.071 ( 3) and 3.061 (3)? There exists an extensive intermolecular hydrogen bond network in the crystal, and pp stacking is observed between the neighboring dafone rings.